ERROR opening https://cactus.nci.nih.gov/chemical/structure/InChI=1S/AsH2O3.Na/c2-1(3)4;/h2-3H;/q-1;+1/file?format=sdf&get3d=True -- InChI=1S/AsH2O3.Na/c2-1(3)4;/h2-3H;/q-1;+1 could not be loaded.