ERROR opening https://cactus.nci.nih.gov/chemical/structure/InChI=1S/BrHO3.H3N/c2-1(3)4;/h(H,2,3,4);1H3/file?format=sdf&get3d=True -- InChI=1S/BrHO3.H3N/c2-1(3)4;/h(H,2,3,4);1H3 could not be loaded.