ERROR opening https://cactus.nci.nih.gov/chemical/structure/InChI=1S/C10H22/c1-6-9(4)7-10(5)8(2)3/h8-10H,6-7H2,1-5H3/t9-,10 /m0/s1/file?format=sdf&get3d=True -- InChI=1S/C10H22/c1-6-9(4)7-10(5)8(2)3/h8-10H,6-7H2,1-5H3/t9-,10 /m0/s1 could not be loaded.