ERROR opening https://cactus.nci.nih.gov/chemical/structure/InChI=1S/C15H24/c1-11(2)13-7-9-15(4)8-5-6-12(3)14(15)10-13/h6,13-14H,1,5,7-10H2,2-4H3/t13-,14 ,15-/m1/s1/file?format=sdf&get3d=True -- InChI=1S/C15H24/c1-11(2)13-7-9-15(4)8-5-6-12(3)14(15)10-13/h6,13-14H,1,5,7-10H2,2-4H3/t13-,14 ,15-/m1/s1 could not be loaded.