ERROR opening https://cactus.nci.nih.gov/chemical/structure/InChI=1S/C16H28O/c1-14(2)8-5-9-15(3)12(14)6-10-16(4)13(15)7-11-17-16/h12-13H,5-11H2,1-4H3/t12-,13 ,15-,16 /m0/s1/file?format=sdf&get3d=True -- InChI=1S/C16H28O/c1-14(2)8-5-9-15(3)12(14)6-10-16(4)13(15)7-11-17-16/h12-13H,5-11H2,1-4H3/t12-,13 ,15-,16 /m0/s1 could not be loaded.