ERROR opening https://cactus.nci.nih.gov/chemical/structure/InChI=1S/C20H32/c1-15(2)18-12-14-20(5)13-11-17(4)8-6-7-16(3)9-10-19(18)20/h7,11,19H,6,8-10,12-14H2,1-5H3/b16-7 ,17-11 /t19-,20-/m1/s1/file?format=sdf&get3d=True -- InChI=1S/C20H32/c1-15(2)18-12-14-20(5)13-11-17(4)8-6-7-16(3)9-10-19(18)20/h7,11,19H,6,8-10,12-14H2,1-5H3/b16-7 ,17-11 /t19-,20-/m1/s1 could not be loaded.