ERROR opening;/h(H,3,4)(H,5,6);/q;+2/p-2/file?format=sdf&get3d=True -- InChI=1S/C2H2O4.Be/c3-1(4)2(5)6;/h(H,3,4)(H,5,6);/q;+2/p-2 could not be loaded.