ERROR opening https://cactus.nci.nih.gov/chemical/structure/InChI=1S/C2H2O4.Li/c3-1(4)2(5)6;/h(H,3,4)(H,5,6);/q;+1/p-1/file?format=sdf&get3d=True -- InChI=1S/C2H2O4.Li/c3-1(4)2(5)6;/h(H,3,4)(H,5,6);/q;+1/p-1 could not be loaded.