ERROR opening https://cactus.nci.nih.gov/chemical/structure/InChI=1S/C2H4O2.Rb/c1-2(3)4;/h1H3,(H,3,4);/q;+1/p-1/file?format=sdf&get3d=True -- InChI=1S/C2H4O2.Rb/c1-2(3)4;/h1H3,(H,3,4);/q;+1/p-1 could not be loaded.