ERROR opening https://cactus.nci.nih.gov/chemical/structure/InChI=1S/C2H4O3.Na/c3-1-2(4)5;/h3H,1H2,(H,4,5);/q;+1/p-1/file?format=sdf&get3d=True -- InChI=1S/C2H4O3.Na/c3-1-2(4)5;/h3H,1H2,(H,4,5);/q;+1/p-1 could not be loaded.