ERROR opening https://cactus.nci.nih.gov/chemical/structure/InChI=1S/C3H6O2.Ag/c1-2-3(4)5;/h2H2,1H3,(H,4,5);/q;+1/p-1/file?format=sdf&get3d=True -- InChI=1S/C3H6O2.Ag/c1-2-3(4)5;/h2H2,1H3,(H,4,5);/q;+1/p-1 could not be loaded.