ERROR opening https://cactus.nci.nih.gov/chemical/structure/InChI=1S/C3H7NO2.Na/c1-4-2-3(5)6;/h4H,2H2,1H3,(H,5,6);/q;+1/p-1/file?format=sdf&get3d=True -- InChI=1S/C3H7NO2.Na/c1-4-2-3(5)6;/h4H,2H2,1H3,(H,5,6);/q;+1/p-1 could not be loaded.