ERROR opening;/h1-2H2,(H,5,6)(H,7,8);/q;+2/p-2/file?format=sdf&get3d=True -- InChI=1S/C4H6O4.Ca/c5-3(6)1-2-4(7)8;/h1-2H2,(H,5,6)(H,7,8);/q;+2/p-2 could not be loaded.