ERROR opening https://cactus.nci.nih.gov/chemical/structure/InChI=1S/C8H14O/c1-4-6-8(9)7(3)5-2/h4,6-7H,5H2,1-3H3/b6-4 /file?format=sdf&get3d=True -- InChI=1S/C8H14O/c1-4-6-8(9)7(3)5-2/h4,6-7H,5H2,1-3H3/b6-4 could not be loaded.