ERROR opening https://cactus.nci.nih.gov/chemical/structure/InChI=1S/CH2O3.2Cu/c2-1(3)4;;/h(H2,2,3,4);;/q;2*+1/p-2/file?format=sdf&get3d=True -- InChI=1S/CH2O3.2Cu/c2-1(3)4;;/h(H2,2,3,4);;/q;2*+1/p-2 could not be loaded.