ERROR opening https://cactus.nci.nih.gov/chemical/structure/InChI=1S/CH2O3.Li/c2-1(3)4;/h(H2,2,3,4);/q;+1/p-1/file?format=sdf&get3d=True -- InChI=1S/CH2O3.Li/c2-1(3)4;/h(H2,2,3,4);/q;+1/p-1 could not be loaded.