ERROR opening https://cactus.nci.nih.gov/chemical/structure/InChI=1S/FHO2S.K/c1-4(2)3;/h(H,2,3);/q;+1/p-1/file?format=sdf&get3d=True -- InChI=1S/FHO2S.K/c1-4(2)3;/h(H,2,3);/q;+1/p-1 could not be loaded.