ERROR opening https://cactus.nci.nih.gov/chemical/structure/InChI=1S/GeO3.2Na/c2-1(3)4;;/q-2;2*+1/file?format=sdf&get3d=True -- InChI=1S/GeO3.2Na/c2-1(3)4;;/q-2;2*+1 could not be loaded.