ERROR opening https://cactus.nci.nih.gov/chemical/structure/InChI=1S/C16H20N2/c1-9-5-13(6-10(2)15(9)17)14-7-11(3)16(18)12(4)8-14/h5- 8H,17-18H2,1-4H3/file?format=sdf&get3d=True -- InChI=1S/C16H20N2/c1-9-5-13(6-10(2)15(9)17)14-7-11(3)16(18)12(4)8-14/h5- 8H,17-18H2,1-4H3 could not be loaded.