ERROR opening https://cactus.nci.nih.gov/chemical/structure/InChI=1/C18H12/c1-3-7-15-13(5-1)
9-11-18-16-8-4-2-6-14
(16)10-12-17(15)18/h1-12H/file?format=sdf&get3d=True -- InChI=1/C18H12/c1-3-7-15-13(5-1)
9-11-18-16-8-4-2-6-14
(16)10-12-17(15)18/h1-12H could not be loaded.