ERROR opening https://cactus.nci.nih.gov/chemical/structure/InChI=1/C9H10Cl2N2O/c1-13(2)
9(14)12-6-3-4-7(10)8(11)5-6/h3
-5H,1-2H3,(H,12,14)/f/h12H/file?format=sdf&get3d=True -- InChI=1/C9H10Cl2N2O/c1-13(2)
9(14)12-6-3-4-7(10)8(11)5-6/h3
-5H,1-2H3,(H,12,14)/f/h12H could not be loaded.