ERROR opening https://cactus.nci.nih.gov/chemical/structure/InChI=1S/C7H14O7/c8-1-3(10)5(12)7(14)6(13)4(11)2-9/h3,5-10,12-14H,1-2H2/t3-,5-,6-,7 /m1/s1/file?format=sdf&get3d=True -- InChI=1S/C7H14O7/c8-1-3(10)5(12)7(14)6(13)4(11)2-9/h3,5-10,12-14H,1-2H2/t3-,5-,6-,7 /m1/s1 could not be loaded.