ERROR opening https://cactus.nci.nih.gov/chemical/structure/InChI=1S/C14H24N2O7/c1-5-4-6(17)14(20)13(21-5)22-12-10(19)7(15-2)9(18)8(16-3)11(12)23-14/h5,7-13,15-16,18-20H,4H2,1-3H3/t5-,7-,8 ,9 ,10 ,11-,12-,13 ,14 /m1/s1/file?format=sdf&get3d=True -- InChI=1S/C14H24N2O7/c1-5-4-6(17)14(20)13(21-5)22-12-10(19)7(15-2)9(18)8(16-3)11(12)23-14/h5,7-13,15-16,18-20H,4H2,1-3H3/t5-,7-,8 ,9 ,10 ,11-,12-,13 ,14 /m1/s1 could not be loaded.