ERROR opening https://cactus.nci.nih.gov/chemical/structure/InChI=1/CHCl3/c2-1(3)4/h1H/file?format=sdf&get3d=True -- InChI=1/CHCl3/c2-1(3)4/h1H could not be loaded.